About N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide
N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide (PubChem CID 143329472) has the molecular formula C12H17N5O
and a molecular weight of 247.30 g/mol. Its IUPAC name is N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide |
| PubChem CID | 143329472 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide |
| SMILES | C/N=C(C)/C(=N\C)C(=N/c1cccc(C)n1)/NO |
| InChI | InChI=1S/C12H17N5O/c1-8-6-5-7-10(15-8)16-12(17-18)11(14-4)9(2)13-3/h5-7,18H,1-4H3,(H,15,16,17)/b13-9+,14-11+ |
| InChIKey | DLSFVIJCEKWYPA-IJFRVEDASA-N |
| XLogP | 1.56 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide?
The IUPAC name of N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide (CID 143329472) is N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide.
What is the SMILES notation for N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide?
The canonical SMILES for N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide is C/N=C(C)/C(=N\C)C(=N/c1cccc(C)n1)/NO.
What is the InChIKey of N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide?
The InChIKey is DLSFVIJCEKWYPA-IJFRVEDASA-N. The full InChI is InChI=1S/C12H17N5O/c1-8-6-5-7-10(15-8)16-12(17-18)11(14-4)9(2)13-3/h5-7,18H,1-4H3,(H,15,16,17)/b13-9+,14-11+.
What are the key properties of N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide?
N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide has a molecular weight of 247.30 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2,3-bis(methylimino)-N'-(6-methyl-2-pyridinyl)butanimidamide is sourced from PubChem (CID 143329472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).