C12H17NO2 — CID 143330540
2-(3-ethyl-4-methoxy-5-methylphenyl)acetamide (PubChem CID 143330540) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(3-ethyl-4-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-(3-ethyl-4-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 143330540 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(3-ethyl-4-methoxy-5-methylphenyl)acetamide |
| SMILES | CCc1cc(CC(N)=O)cc(C)c1OC |
| InChI | InChI=1S/C12H17NO2/c1-4-10-6-9(7-11(13)14)5-8(2)12(10)15-3/h5-6H,4,7H2,1-3H3,(H2,13,14) |
| InChIKey | VNLDOSCMBNWOBH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |