C14H18ClNO3 — CID 143334088
(1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 143334088) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 143334088 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[[(1R)-cyclohex-2-en-1-yl]methyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | O=C1N[C@@]2(C[C@@H]3C=CCCC3)C(=O)O[C@H]2[C@H]1CCCl |
| InChI | InChI=1S/C14H18ClNO3/c15-7-6-10-11-14(13(18)19-11,16-12(10)17)8-9-4-2-1-3-5-9/h2,4,9-11H,1,3,5-8H2,(H,16,17)/t9-,10-,11+,14-/m1/s1 |
| InChIKey | XLMJZWYSLFJCKO-NJBDSQKTSA-N |
| XLogP | 1.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|