C37H59N5 — CID 143334433
(3Z)-N-ethenyl-4-[(4-ethenyl-3-ethylcyclohexa-2,4-dien-1-yl)methyl]-7-methyl-3-propan-2-yl-8-[(4Z)-7-prop-1-en-2-yl-1,3,6,9-tetrazacyclotrideca-1,4-dien-5-yl]octa-3,5-dien-1-amine (PubChem CID 143334433) has the molecular formula C37H59N5 and a molecular weight of 573.91 g/mol. Its IUPAC name is (3Z)-N-ethenyl-4-[(4-ethenyl-3-ethylcyclohexa-2,4-dien-1-yl)methyl]-7-methyl-3-propan-2-yl-8-[(4Z)-7-prop-1-en-2-yl-1,3,6,9-tetrazacyclotrideca-1,4-dien-5-yl]octa-3,5-dien-1-amine.
| Compound Name | (3Z)-N-ethenyl-4-[(4-ethenyl-3-ethylcyclohexa-2,4-dien-1-yl)methyl]-7-methyl-3-propan-2-yl-8-[(4Z)-7-prop-1-en-2-yl-1,3,6,9-tetrazacyclotrideca-1,4-dien-5-yl]octa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143334433 |
| Molecular Formula | C37H59N5 |
| Molecular Weight | 573.91 g/mol |
| Exact Mass | 573.48 |
| IUPAC Name | (3Z)-N-ethenyl-4-[(4-ethenyl-3-ethylcyclohexa-2,4-dien-1-yl)methyl]-7-methyl-3-propan-2-yl-8-[(4Z)-7-prop-1-en-2-yl-1,3,6,9-tetrazacyclotrideca-1,4-dien-5-yl]octa-3,5-dien-1-amine |
| SMILES | C=CNCC/C(=C(/C=CC(C)C/C1=C/N/C=N\CCCCNCC(C(=C)C)N1)CC1C=C(CC)C(C=C)=CC1)C(C)C |
| InChI | InChI=1S/C37H59N5/c1-9-32-17-15-31(23-33(32)10-2)24-34(36(28(4)5)18-21-38-11-3)16-14-30(8)22-35-25-41-27-40-20-13-12-19-39-26-37(42-35)29(6)7/h9,11,14,16-17,23,25,27-28,30-31,37-39,42H,1,3,6,10,12-13,15,18-22,24,26H2,2,4-5,7-8H3,(H,40,41)/b16-14?,35-25-,36-34+ |
| InChIKey | BFKKRNCCGIJPST-WMDOANSKSA-N |
| XLogP | 7.88 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.91 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|