C18H16ClN3O3S — CID 143335022
(5Z)-5-[[4-[2-[chloro(pyridin-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazinane-2,4-dione (PubChem CID 143335022) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-[chloro(pyridin-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazinane-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-[chloro(pyridin-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazinane-2,4-dione |
|---|---|
| PubChem CID | 143335022 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (5Z)-5-[[4-[2-[chloro(pyridin-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazinane-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OCCN(Cl)c3ccccn3)cc2)CS1 |
| InChI | InChI=1S/C18H16ClN3O3S/c19-22(16-3-1-2-8-20-16)9-10-25-15-6-4-13(5-7-15)11-14-12-26-18(24)21-17(14)23/h1-8,11H,9-10,12H2,(H,21,23,24)/b14-11+ |
| InChIKey | WPUIWBKTGRONKY-SDNWHVSQSA-N |
| XLogP | 3.49 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|