C16H20O3 — CID 143335594
3-acetyl-3-(2,5-dimethylphenyl)hexane-2,5-dione (PubChem CID 143335594) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-acetyl-3-(2,5-dimethylphenyl)hexane-2,5-dione.
| Compound Name | 3-acetyl-3-(2,5-dimethylphenyl)hexane-2,5-dione |
|---|---|
| PubChem CID | 143335594 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-acetyl-3-(2,5-dimethylphenyl)hexane-2,5-dione |
| SMILES | CC(=O)CC(C(C)=O)(C(C)=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H20O3/c1-10-6-7-11(2)15(8-10)16(13(4)18,14(5)19)9-12(3)17/h6-8H,9H2,1-5H3 |
| InChIKey | UDASRCMQJUASNA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|