About 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol
3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol (PubChem CID 143994165) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol.
Molecular Properties
| Compound Name | 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol |
| PubChem CID | 143994165 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol |
| SMILES | CC.CC(=O)C(C)(C)c1ccc(C)cc1C.CCCO |
| InChI | InChI=1S/C13H18O.C3H8O.C2H6/c1-9-6-7-12(10(2)8-9)13(4,5)11(3)14;1-2-3-4;1-2/h6-8H,1-5H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | RSMNWGYKSSLAAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol?
The IUPAC name of 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol (CID 143994165) is 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol.
What is the SMILES notation for 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol?
The canonical SMILES for 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol is CC.CC(=O)C(C)(C)c1ccc(C)cc1C.CCCO.
What is the InChIKey of 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol?
The InChIKey is RSMNWGYKSSLAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O.C3H8O.C2H6/c1-9-6-7-12(10(2)8-9)13(4,5)11(3)14;1-2-3-4;1-2/h6-8H,1-5H3;4H,2-3H2,1H3;1-2H3.
What are the key properties of 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol?
3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol has a molecular weight of 280.45 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol is sourced from PubChem (CID 143994165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).