C18H32O2 — CID 143994165
3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol (PubChem CID 143994165) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol.
| Compound Name | 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol |
|---|---|
| PubChem CID | 143994165 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-3-methylbutan-2-one;ethane;propan-1-ol |
| SMILES | CC.CC(=O)C(C)(C)c1ccc(C)cc1C.CCCO |
| InChI | InChI=1S/C13H18O.C3H8O.C2H6/c1-9-6-7-12(10(2)8-9)13(4,5)11(3)14;1-2-3-4;1-2/h6-8H,1-5H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | RSMNWGYKSSLAAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |