C22H22N2O5 — CID 143335596
2-[3-acetyl-5-methyl-2-oxo-3-(3-phenylpropanoylamino)indol-1-yl]acetic acid (PubChem CID 143335596) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[3-acetyl-5-methyl-2-oxo-3-(3-phenylpropanoylamino)indol-1-yl]acetic acid.
| Compound Name | 2-[3-acetyl-5-methyl-2-oxo-3-(3-phenylpropanoylamino)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 143335596 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[3-acetyl-5-methyl-2-oxo-3-(3-phenylpropanoylamino)indol-1-yl]acetic acid |
| SMILES | CC(=O)C1(NC(=O)CCc2ccccc2)C(=O)N(CC(=O)O)c2ccc(C)cc21 |
| InChI | InChI=1S/C22H22N2O5/c1-14-8-10-18-17(12-14)22(15(2)25,21(29)24(18)13-20(27)28)23-19(26)11-9-16-6-4-3-5-7-16/h3-8,10,12H,9,11,13H2,1-2H3,(H,23,26)(H,27,28) |
| InChIKey | QPLTXEWOVNCSOM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|