C24H24ClNOS — CID 143337862
N-[2-(4-chlorophenyl)phenyl]sulfanyl-4-methoxy-N-methyl-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 143337862) has the molecular formula C24H24ClNOS and a molecular weight of 409.98 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)phenyl]sulfanyl-4-methoxy-N-methyl-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-[2-(4-chlorophenyl)phenyl]sulfanyl-4-methoxy-N-methyl-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 143337862 |
| Molecular Formula | C24H24ClNOS |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)phenyl]sulfanyl-4-methoxy-N-methyl-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | COc1ccc(N(C)Sc2ccccc2-c2ccc(Cl)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C24H24ClNOS/c1-26(22-15-16-23(27-2)21-9-4-3-8-20(21)22)28-24-10-6-5-7-19(24)17-11-13-18(25)14-12-17/h5-7,10-16H,3-4,8-9H2,1-2H3 |
| InChIKey | JUHBINJXZRGOMD-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|