C20H29N2O5P — CID 143340102
[1-amino-2-[4-(3-ethyl-4-nitrosophenoxy)-3,5-dimethylphenyl]ethyl]phosphonic acid;ethane (PubChem CID 143340102) has the molecular formula C20H29N2O5P and a molecular weight of 408.44 g/mol. Its IUPAC name is [1-amino-2-[4-(3-ethyl-4-nitrosophenoxy)-3,5-dimethylphenyl]ethyl]phosphonic acid;ethane.
| Compound Name | [1-amino-2-[4-(3-ethyl-4-nitrosophenoxy)-3,5-dimethylphenyl]ethyl]phosphonic acid;ethane |
|---|---|
| PubChem CID | 143340102 |
| Molecular Formula | C20H29N2O5P |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [1-amino-2-[4-(3-ethyl-4-nitrosophenoxy)-3,5-dimethylphenyl]ethyl]phosphonic acid;ethane |
| SMILES | CC.CCc1cc(Oc2c(C)cc(CC(N)P(=O)(O)O)cc2C)ccc1N=O |
| InChI | InChI=1S/C18H23N2O5P.C2H6/c1-4-14-10-15(5-6-16(14)20-21)25-18-11(2)7-13(8-12(18)3)9-17(19)26(22,23)24;1-2/h5-8,10,17H,4,9,19H2,1-3H3,(H2,22,23,24);1-2H3 |
| InChIKey | IVOSAYXCFCPDMF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|