C21H17Br2FNO5P — CID 143340058
[3,5-dibromo-4-[3-[(4-fluorophenyl)methyl]-4-nitrosophenoxy]phenoxy]methyl-methylphosphinic acid (PubChem CID 143340058) has the molecular formula C21H17Br2FNO5P and a molecular weight of 573.15 g/mol. Its IUPAC name is [3,5-dibromo-4-[3-[(4-fluorophenyl)methyl]-4-nitrosophenoxy]phenoxy]methyl-methylphosphinic acid.
| Compound Name | [3,5-dibromo-4-[3-[(4-fluorophenyl)methyl]-4-nitrosophenoxy]phenoxy]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 143340058 |
| Molecular Formula | C21H17Br2FNO5P |
| Molecular Weight | 573.15 g/mol |
| Exact Mass | 570.92 |
| IUPAC Name | [3,5-dibromo-4-[3-[(4-fluorophenyl)methyl]-4-nitrosophenoxy]phenoxy]methyl-methylphosphinic acid |
| SMILES | CP(=O)(O)COc1cc(Br)c(Oc2ccc(N=O)c(Cc3ccc(F)cc3)c2)c(Br)c1 |
| InChI | InChI=1S/C21H17Br2FNO5P/c1-31(27,28)12-29-17-10-18(22)21(19(23)11-17)30-16-6-7-20(25-26)14(9-16)8-13-2-4-15(24)5-3-13/h2-7,9-11H,8,12H2,1H3,(H,27,28) |
| InChIKey | FBJAFWZTQQTSNI-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.15 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|