About 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate
3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate (PubChem CID 143340709) has the molecular formula C21H36N4O2
and a molecular weight of 376.55 g/mol. Its IUPAC name is 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate.
Molecular Properties
| Compound Name | 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate |
| PubChem CID | 143340709 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate |
| SMILES | CCCN(CCC)c1cc(N)nc(CCCOC(=O)CN2CCCCC2)c1 |
| InChI | InChI=1S/C21H36N4O2/c1-3-10-25(11-4-2)19-15-18(23-20(22)16-19)9-8-14-27-21(26)17-24-12-6-5-7-13-24/h15-16H,3-14,17H2,1-2H3,(H2,22,23) |
| InChIKey | YBRRRBUAXPCCCS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate?
The IUPAC name of 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate (CID 143340709) is 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate.
What is the SMILES notation for 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate?
The canonical SMILES for 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate is CCCN(CCC)c1cc(N)nc(CCCOC(=O)CN2CCCCC2)c1.
What is the InChIKey of 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate?
The InChIKey is YBRRRBUAXPCCCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N4O2/c1-3-10-25(11-4-2)19-15-18(23-20(22)16-19)9-8-14-27-21(26)17-24-12-6-5-7-13-24/h15-16H,3-14,17H2,1-2H3,(H2,22,23).
What are the key properties of 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate?
3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate has a molecular weight of 376.55 g/mol, XLogP of 3.25, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate is sourced from PubChem (CID 143340709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).