C21H36N4O2 — CID 143340709
3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate (PubChem CID 143340709) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate.
| Compound Name | 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 143340709 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 3-[6-amino-4-(dipropylamino)-2-pyridinyl]propyl 2-piperidin-1-ylacetate |
| SMILES | CCCN(CCC)c1cc(N)nc(CCCOC(=O)CN2CCCCC2)c1 |
| InChI | InChI=1S/C21H36N4O2/c1-3-10-25(11-4-2)19-15-18(23-20(22)16-19)9-8-14-27-21(26)17-24-12-6-5-7-13-24/h15-16H,3-14,17H2,1-2H3,(H2,22,23) |
| InChIKey | YBRRRBUAXPCCCS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|