C28H39N3O4 — CID 143341369
4-[formyl(2-methoxyethyl)amino]-N-methyl-1-[(3-methylphenyl)methyl]-N-(3-phenoxypropyl)piperidine-4-carboxamide (PubChem CID 143341369) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is 4-[formyl(2-methoxyethyl)amino]-N-methyl-1-[(3-methylphenyl)methyl]-N-(3-phenoxypropyl)piperidine-4-carboxamide.
| Compound Name | 4-[formyl(2-methoxyethyl)amino]-N-methyl-1-[(3-methylphenyl)methyl]-N-(3-phenoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 143341369 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 4-[formyl(2-methoxyethyl)amino]-N-methyl-1-[(3-methylphenyl)methyl]-N-(3-phenoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCN(C=O)C1(C(=O)N(C)CCCOc2ccccc2)CCN(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C28H39N3O4/c1-24-9-7-10-25(21-24)22-30-16-13-28(14-17-30,31(23-32)18-20-34-3)27(33)29(2)15-8-19-35-26-11-5-4-6-12-26/h4-7,9-12,21,23H,8,13-20,22H2,1-3H3 |
| InChIKey | XUGGWRMQINKOBW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|