C18H28N2O2 — CID 143343022
2-aminopropanal;3-(7-ethyl-3,4-dihydro-2H-quinolin-1-yl)butan-2-one (PubChem CID 143343022) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-aminopropanal;3-(7-ethyl-3,4-dihydro-2H-quinolin-1-yl)butan-2-one.
| Compound Name | 2-aminopropanal;3-(7-ethyl-3,4-dihydro-2H-quinolin-1-yl)butan-2-one |
|---|---|
| PubChem CID | 143343022 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-aminopropanal;3-(7-ethyl-3,4-dihydro-2H-quinolin-1-yl)butan-2-one |
| SMILES | CC(N)C=O.CCc1ccc2c(c1)N(C(C)C(C)=O)CCC2 |
| InChI | InChI=1S/C15H21NO.C3H7NO/c1-4-13-7-8-14-6-5-9-16(15(14)10-13)11(2)12(3)17;1-3(4)2-5/h7-8,10-11H,4-6,9H2,1-3H3;2-3H,4H2,1H3 |
| InChIKey | ZVOIHJMRGXHXJE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|