C17H26N2O2 — CID 143345198
(Z)-4-amino-5-[(4-ethyl-2-methylphenyl)methylamino]pent-4-ene-2,3-dione;ethane (PubChem CID 143345198) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (Z)-4-amino-5-[(4-ethyl-2-methylphenyl)methylamino]pent-4-ene-2,3-dione;ethane.
| Compound Name | (Z)-4-amino-5-[(4-ethyl-2-methylphenyl)methylamino]pent-4-ene-2,3-dione;ethane |
|---|---|
| PubChem CID | 143345198 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (Z)-4-amino-5-[(4-ethyl-2-methylphenyl)methylamino]pent-4-ene-2,3-dione;ethane |
| SMILES | CC.CCc1ccc(CN/C=C(\N)C(=O)C(C)=O)c(C)c1 |
| InChI | InChI=1S/C15H20N2O2.C2H6/c1-4-12-5-6-13(10(2)7-12)8-17-9-14(16)15(19)11(3)18;1-2/h5-7,9,17H,4,8,16H2,1-3H3;1-2H3/b14-9-; |
| InChIKey | OLQNRTJCQHSJLF-WQRRWHLMSA-N |
| XLogP | 2.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|