C19H38 — CID 143345986
1,2,4-trimethyl-5-(6-methyloctan-2-yl)cycloheptane (PubChem CID 143345986) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is 1,2,4-trimethyl-5-(6-methyloctan-2-yl)cycloheptane.
| Compound Name | 1,2,4-trimethyl-5-(6-methyloctan-2-yl)cycloheptane |
|---|---|
| PubChem CID | 143345986 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 1,2,4-trimethyl-5-(6-methyloctan-2-yl)cycloheptane |
| SMILES | CCC(C)CCCC(C)C1CCC(C)C(C)CC1C |
| InChI | InChI=1S/C19H38/c1-7-14(2)9-8-10-16(4)19-12-11-15(3)17(5)13-18(19)6/h14-19H,7-13H2,1-6H3 |
| InChIKey | NIIZEUIUZQYJCU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |