C24H18N2O3 — CID 143349054
4-[(4Z)-3-cyclopropyl-4-(naphthalen-2-ylmethylidene)-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 143349054) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[(4Z)-3-cyclopropyl-4-(naphthalen-2-ylmethylidene)-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-3-cyclopropyl-4-(naphthalen-2-ylmethylidene)-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 143349054 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-[(4Z)-3-cyclopropyl-4-(naphthalen-2-ylmethylidene)-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2N=C(C3CC3)/C(=C/c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C24H18N2O3/c27-23-21(14-15-5-6-16-3-1-2-4-19(16)13-15)22(17-7-8-17)25-26(23)20-11-9-18(10-12-20)24(28)29/h1-6,9-14,17H,7-8H2,(H,28,29)/b21-14- |
| InChIKey | BUYQYIANUGINIQ-STZFKDTASA-N |
| XLogP | 4.73 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|