C19H12BrF3N2O4 — CID 1273153
4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid (PubChem CID 1273153) has the molecular formula C19H12BrF3N2O4 and a molecular weight of 469.21 g/mol. Its IUPAC name is 4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 1273153 |
| Molecular Formula | C19H12BrF3N2O4 |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
| SMILES | COc1ccc(/C=C2\C(=O)N(c3ccc(C(=O)O)cc3)N=C2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C19H12BrF3N2O4/c1-29-15-7-2-10(9-14(15)20)8-13-16(19(21,22)23)24-25(17(13)26)12-5-3-11(4-6-12)18(27)28/h2-9H,1H3,(H,27,28)/b13-8- |
| InChIKey | HOHNEHSZFDCPAH-JYRVWZFOSA-N |
| XLogP | 4.50 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|