C21H16ClF3N2O5 — CID 4260772
ethyl 4-[4-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate (PubChem CID 4260772) has the molecular formula C21H16ClF3N2O5 and a molecular weight of 468.82 g/mol. Its IUPAC name is ethyl 4-[4-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 4260772 |
| Molecular Formula | C21H16ClF3N2O5 |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | ethyl 4-[4-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2N=C(C(F)(F)F)C(=Cc3cc(Cl)c(O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H16ClF3N2O5/c1-3-32-20(30)12-4-6-13(7-5-12)27-19(29)14(18(26-27)21(23,24)25)8-11-9-15(22)17(28)16(10-11)31-2/h4-10,28H,3H2,1-2H3 |
| InChIKey | JBNWSSBKZRGULN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|