C21H18F3N3O6S — CID 3381174
[2-methoxy-4-[[5-oxo-1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-4-ylidene]methyl]phenyl] propanoate (PubChem CID 3381174) has the molecular formula C21H18F3N3O6S and a molecular weight of 497.45 g/mol. Its IUPAC name is [2-methoxy-4-[[5-oxo-1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-4-ylidene]methyl]phenyl] propanoate.
| Compound Name | [2-methoxy-4-[[5-oxo-1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-4-ylidene]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 3381174 |
| Molecular Formula | C21H18F3N3O6S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | [2-methoxy-4-[[5-oxo-1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-4-ylidene]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C=C2C(=O)N(c3ccc(S(N)(=O)=O)cc3)N=C2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C21H18F3N3O6S/c1-3-18(28)33-16-9-4-12(11-17(16)32-2)10-15-19(21(22,23)24)26-27(20(15)29)13-5-7-14(8-6-13)34(25,30)31/h4-11H,3H2,1-2H3,(H2,25,30,31) |
| InChIKey | VOTKKINARGPNEP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|