C24H15F3N2O7 — CID 3310804
3-[4-[[4-(furan-2-carbonyloxy)-3-methoxyphenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid (PubChem CID 3310804) has the molecular formula C24H15F3N2O7 and a molecular weight of 500.39 g/mol. Its IUPAC name is 3-[4-[[4-(furan-2-carbonyloxy)-3-methoxyphenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid.
| Compound Name | 3-[4-[[4-(furan-2-carbonyloxy)-3-methoxyphenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3310804 |
| Molecular Formula | C24H15F3N2O7 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 3-[4-[[4-(furan-2-carbonyloxy)-3-methoxyphenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
| SMILES | COc1cc(C=C2C(=O)N(c3cccc(C(=O)O)c3)N=C2C(F)(F)F)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C24H15F3N2O7/c1-34-19-11-13(7-8-17(19)36-23(33)18-6-3-9-35-18)10-16-20(24(25,26)27)28-29(21(16)30)15-5-2-4-14(12-15)22(31)32/h2-12H,1H3,(H,31,32) |
| InChIKey | XEWXMAFEBBCUER-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|