C23H21ClF3N3O3 — CID 3486875
ethyl 4-[4-[[4-[2-chloroethyl(methyl)amino]phenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate (PubChem CID 3486875) has the molecular formula C23H21ClF3N3O3 and a molecular weight of 479.89 g/mol. Its IUPAC name is ethyl 4-[4-[[4-[2-chloroethyl(methyl)amino]phenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[4-[2-chloroethyl(methyl)amino]phenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 3486875 |
| Molecular Formula | C23H21ClF3N3O3 |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | ethyl 4-[4-[[4-[2-chloroethyl(methyl)amino]phenyl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2N=C(C(F)(F)F)C(=Cc3ccc(N(C)CCCl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H21ClF3N3O3/c1-3-33-22(32)16-6-10-18(11-7-16)30-21(31)19(20(28-30)23(25,26)27)14-15-4-8-17(9-5-15)29(2)13-12-24/h4-11,14H,3,12-13H2,1-2H3 |
| InChIKey | SZBWEDUATZANLC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|