C28H22N4O4S — CID 143349110
N-[4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenyl]naphthalene-2-carboxamide (PubChem CID 143349110) has the molecular formula C28H22N4O4S and a molecular weight of 510.58 g/mol. Its IUPAC name is N-[4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 143349110 |
| Molecular Formula | C28H22N4O4S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-[4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenyl]naphthalene-2-carboxamide |
| SMILES | CC1=NN(c2ccc(S(N)(=O)=O)cc2)C(=O)/C1=C\c1ccc(NC(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C28H22N4O4S/c1-18-26(28(34)32(31-18)24-12-14-25(15-13-24)37(29,35)36)16-19-6-10-23(11-7-19)30-27(33)22-9-8-20-4-2-3-5-21(20)17-22/h2-17H,1H3,(H,30,33)(H2,29,35,36)/b26-16- |
| InChIKey | BDIJYSJKDCHAQX-QQXSKIMKSA-N |
| XLogP | 4.55 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|