C24H19FN4O2S — CID 143348980
N-[4-[(Z)-[1-(4-aminosulfanylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenyl]-2-fluorobenzamide (PubChem CID 143348980) has the molecular formula C24H19FN4O2S and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[4-[(Z)-[1-(4-aminosulfanylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(Z)-[1-(4-aminosulfanylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 143348980 |
| Molecular Formula | C24H19FN4O2S |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[4-[(Z)-[1-(4-aminosulfanylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenyl]-2-fluorobenzamide |
| SMILES | CC1=NN(c2ccc(SN)cc2)C(=O)/C1=C\c1ccc(NC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C24H19FN4O2S/c1-15-21(24(31)29(28-15)18-10-12-19(32-26)13-11-18)14-16-6-8-17(9-7-16)27-23(30)20-4-2-3-5-22(20)25/h2-14H,26H2,1H3,(H,27,30)/b21-14- |
| InChIKey | JJBMBBREDCABGW-STZFKDTASA-N |
| XLogP | 4.85 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|