C27H26N4O4 — CID 19655856
N-[4-[(4E)-4-[[4-(2-anilino-2-hydroxyethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]acetamide (PubChem CID 19655856) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[4-[(4E)-4-[[4-(2-anilino-2-hydroxyethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4E)-4-[[4-(2-anilino-2-hydroxyethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 19655856 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-[4-[(4E)-4-[[4-(2-anilino-2-hydroxyethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2N=C(C)/C(=C\c3ccc(OCC(O)Nc4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26N4O4/c1-18-25(27(34)31(30-18)23-12-10-22(11-13-23)28-19(2)32)16-20-8-14-24(15-9-20)35-17-26(33)29-21-6-4-3-5-7-21/h3-16,26,29,33H,17H2,1-2H3,(H,28,32)/b25-16+ |
| InChIKey | ZCUCHZUAMVINFU-PCLIKHOPSA-N |
| XLogP | 4.26 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|