C13H20O3 — CID 143349337
ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyoxolan-2-one (PubChem CID 143349337) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyoxolan-2-one.
| Compound Name | ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyoxolan-2-one |
|---|---|
| PubChem CID | 143349337 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyoxolan-2-one |
| SMILES | C=C/C=C\C(=C/C)OC1CCOC1=O.CC |
| InChI | InChI=1S/C11H14O3.C2H6/c1-3-5-6-9(4-2)14-10-7-8-13-11(10)12;1-2/h3-6,10H,1,7-8H2,2H3;1-2H3/b6-5-,9-4+; |
| InChIKey | CQGLKPUBITYMEW-YWPNFKROSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|