C23H41IN4O4 — CID 143352465
(2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-(dimethyl-λ3-iodanyl)-N-[1-(methylamino)-1,2-dioxoheptan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 143352465) has the molecular formula C23H41IN4O4 and a molecular weight of 564.51 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-(dimethyl-λ3-iodanyl)-N-[1-(methylamino)-1,2-dioxoheptan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-(dimethyl-λ3-iodanyl)-N-[1-(methylamino)-1,2-dioxoheptan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143352465 |
| Molecular Formula | C23H41IN4O4 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-(dimethyl-λ3-iodanyl)-N-[1-(methylamino)-1,2-dioxoheptan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCCC(NC(=O)[C@@H]1C[C@@H](I(C)C)CN1C(=O)[C@@H](N)C1CCCCC1)C(=O)C(=O)NC |
| InChI | InChI=1S/C23H41IN4O4/c1-5-6-12-17(20(29)22(31)26-4)27-21(30)18-13-16(24(2)3)14-28(18)23(32)19(25)15-10-8-7-9-11-15/h15-19H,5-14,25H2,1-4H3,(H,26,31)(H,27,30)/t16-,17?,18+,19+/m1/s1 |
| InChIKey | SNTQCGWXPLPGHT-DXPBQALJSA-N |
| XLogP | 1.62 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|