C10H18N2O2 — CID 143352660
3,3-dimethyl-2-[1-(2-oxoethylamino)ethenylamino]butanal (PubChem CID 143352660) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 3,3-dimethyl-2-[1-(2-oxoethylamino)ethenylamino]butanal.
| Compound Name | 3,3-dimethyl-2-[1-(2-oxoethylamino)ethenylamino]butanal |
|---|---|
| PubChem CID | 143352660 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3,3-dimethyl-2-[1-(2-oxoethylamino)ethenylamino]butanal |
| SMILES | C=C(NCC=O)NC(C=O)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-8(11-5-6-13)12-9(7-14)10(2,3)4/h6-7,9,11-12H,1,5H2,2-4H3 |
| InChIKey | DIXIRVDPHBJNPH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|