C9H17NO2S — CID 59880553
S-ethyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamothioate (PubChem CID 59880553) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is S-ethyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamothioate.
| Compound Name | S-ethyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamothioate |
|---|---|
| PubChem CID | 59880553 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | S-ethyl N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamothioate |
| SMILES | CCSC(=O)N[C@H](C=O)C(C)(C)C |
| InChI | InChI=1S/C9H17NO2S/c1-5-13-8(12)10-7(6-11)9(2,3)4/h6-7H,5H2,1-4H3,(H,10,12)/t7-/m1/s1 |
| InChIKey | MNVCKDPPGOQACG-SSDOTTSWSA-N |
| XLogP | 2.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|