C10H18N2O4 — CID 87561975
[3-[[(2R)-3,3-dimethyl-1-oxobutan-2-yl]amino]-3-oxopropyl]carbamic acid (PubChem CID 87561975) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is [3-[[(2R)-3,3-dimethyl-1-oxobutan-2-yl]amino]-3-oxopropyl]carbamic acid.
| Compound Name | [3-[[(2R)-3,3-dimethyl-1-oxobutan-2-yl]amino]-3-oxopropyl]carbamic acid |
|---|---|
| PubChem CID | 87561975 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | [3-[[(2R)-3,3-dimethyl-1-oxobutan-2-yl]amino]-3-oxopropyl]carbamic acid |
| SMILES | CC(C)(C)[C@H](C=O)NC(=O)CCNC(=O)O |
| InChI | InChI=1S/C10H18N2O4/c1-10(2,3)7(6-13)12-8(14)4-5-11-9(15)16/h6-7,11H,4-5H2,1-3H3,(H,12,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | MGNYPPDORACCNE-ZETCQYMHSA-N |
| XLogP | 0.37 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|