C31H55N5O5 — CID 143354705
N-but-3-enyl-3-[5-[[2-cyclohexyl-2-(ethylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxohept-6-enamide;propane (PubChem CID 143354705) has the molecular formula C31H55N5O5 and a molecular weight of 577.81 g/mol. Its IUPAC name is N-but-3-enyl-3-[5-[[2-cyclohexyl-2-(ethylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxohept-6-enamide;propane.
| Compound Name | N-but-3-enyl-3-[5-[[2-cyclohexyl-2-(ethylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxohept-6-enamide;propane |
|---|---|
| PubChem CID | 143354705 |
| Molecular Formula | C31H55N5O5 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.42 |
| IUPAC Name | N-but-3-enyl-3-[5-[[2-cyclohexyl-2-(ethylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxohept-6-enamide;propane |
| SMILES | C=CCCNC(=O)C(=O)C(CCC=C)NC(=O)CCCCN(C)C(=O)C(NC(=O)NCC)C1CCCCC1.CCC |
| InChI | InChI=1S/C28H47N5O5.C3H8/c1-5-8-17-22(25(35)26(36)30-19-9-6-2)31-23(34)18-13-14-20-33(4)27(37)24(32-28(38)29-7-3)21-15-11-10-12-16-21;1-3-2/h5-6,21-22,24H,1-2,7-20H2,3-4H3,(H,30,36)(H,31,34)(H2,29,32,38);3H2,1-2H3 |
| InChIKey | HEKWAWFGADCXHC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|