C28H47N5O5 — CID 143362159
3-[5-[[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxo-N-prop-2-enylhept-6-ynamide;ethane (PubChem CID 143362159) has the molecular formula C28H47N5O5 and a molecular weight of 533.71 g/mol. Its IUPAC name is 3-[5-[[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxo-N-prop-2-enylhept-6-ynamide;ethane.
| Compound Name | 3-[5-[[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxo-N-prop-2-enylhept-6-ynamide;ethane |
|---|---|
| PubChem CID | 143362159 |
| Molecular Formula | C28H47N5O5 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.36 |
| IUPAC Name | 3-[5-[[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-methylamino]pentanoylamino]-2-oxo-N-prop-2-enylhept-6-ynamide;ethane |
| SMILES | C#CCCC(NC(=O)CCCCN(C)C(=O)C(NC(=O)NC)C1CCCCC1)C(=O)C(=O)NCC=C.CC |
| InChI | InChI=1S/C26H41N5O5.C2H6/c1-5-7-15-20(23(33)24(34)28-17-6-2)29-21(32)16-11-12-18-31(4)25(35)22(30-26(36)27-3)19-13-9-8-10-14-19;1-2/h1,6,19-20,22H,2,7-18H2,3-4H3,(H,28,34)(H,29,32)(H2,27,30,36);1-2H3 |
| InChIKey | MAKGJOVKMRMLCO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|