C19H22N2 — CID 143355963
1-N-methyl-1-N-phenyl-2-N-[(1R)-1-phenylprop-2-enyl]prop-2-ene-1,2-diamine (PubChem CID 143355963) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-N-methyl-1-N-phenyl-2-N-[(1R)-1-phenylprop-2-enyl]prop-2-ene-1,2-diamine.
| Compound Name | 1-N-methyl-1-N-phenyl-2-N-[(1R)-1-phenylprop-2-enyl]prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 143355963 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-N-methyl-1-N-phenyl-2-N-[(1R)-1-phenylprop-2-enyl]prop-2-ene-1,2-diamine |
| SMILES | C=C[C@@H](NC(=C)CN(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2/c1-4-19(17-11-7-5-8-12-17)20-16(2)15-21(3)18-13-9-6-10-14-18/h4-14,19-20H,1-2,15H2,3H3/t19-/m1/s1 |
| InChIKey | BWFNGLWXSHGFFP-LJQANCHMSA-N |
| XLogP | 4.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|