About 1-iodo-1,3-dimethyl-3-phosphanylurea
1-iodo-1,3-dimethyl-3-phosphanylurea (PubChem CID 143356978) has the molecular formula C3H8IN2OP
and a molecular weight of 245.99 g/mol. Its IUPAC name is 1-iodo-1,3-dimethyl-3-phosphanylurea.
Molecular Properties
| Compound Name | 1-iodo-1,3-dimethyl-3-phosphanylurea |
| PubChem CID | 143356978 |
| Molecular Formula | C3H8IN2OP |
| Molecular Weight | 245.99 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 1-iodo-1,3-dimethyl-3-phosphanylurea |
| SMILES | CN(P)C(=O)N(C)I |
| InChI | InChI=1S/C3H8IN2OP/c1-5(4)3(7)6(2)8/h8H2,1-2H3 |
| InChIKey | JNEKMGJMSHGOCU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.99 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-1,3-dimethyl-3-phosphanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-1,3-dimethyl-3-phosphanylurea?
The IUPAC name of 1-iodo-1,3-dimethyl-3-phosphanylurea (CID 143356978) is 1-iodo-1,3-dimethyl-3-phosphanylurea.
What is the SMILES notation for 1-iodo-1,3-dimethyl-3-phosphanylurea?
The canonical SMILES for 1-iodo-1,3-dimethyl-3-phosphanylurea is CN(P)C(=O)N(C)I.
What is the InChIKey of 1-iodo-1,3-dimethyl-3-phosphanylurea?
The InChIKey is JNEKMGJMSHGOCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8IN2OP/c1-5(4)3(7)6(2)8/h8H2,1-2H3.
What are the key properties of 1-iodo-1,3-dimethyl-3-phosphanylurea?
1-iodo-1,3-dimethyl-3-phosphanylurea has a molecular weight of 245.99 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-1,3-dimethyl-3-phosphanylurea is sourced from PubChem (CID 143356978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).