C17H25N3O3 — CID 143358298
1-(3,3-dimethyl-1-oxobutan-2-yl)-3-[2-oxo-2-(1,3,4,5-tetrahydroisoindol-2-yl)ethyl]urea (PubChem CID 143358298) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-(3,3-dimethyl-1-oxobutan-2-yl)-3-[2-oxo-2-(1,3,4,5-tetrahydroisoindol-2-yl)ethyl]urea.
| Compound Name | 1-(3,3-dimethyl-1-oxobutan-2-yl)-3-[2-oxo-2-(1,3,4,5-tetrahydroisoindol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 143358298 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-(3,3-dimethyl-1-oxobutan-2-yl)-3-[2-oxo-2-(1,3,4,5-tetrahydroisoindol-2-yl)ethyl]urea |
| SMILES | CC(C)(C)C(C=O)NC(=O)NCC(=O)N1CC2=C(CCC=C2)C1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)14(11-21)19-16(23)18-8-15(22)20-9-12-6-4-5-7-13(12)10-20/h4,6,11,14H,5,7-10H2,1-3H3,(H2,18,19,23) |
| InChIKey | XGHUFMOMFOMRKT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|