C18H36O — CID 143365281
buta-1,3-dien-2-ol;1-butan-2-yl-1,2,2-trimethylcyclopentane;ethane (PubChem CID 143365281) has the molecular formula C18H36O and a molecular weight of 268.48 g/mol. Its IUPAC name is buta-1,3-dien-2-ol;1-butan-2-yl-1,2,2-trimethylcyclopentane;ethane.
| Compound Name | buta-1,3-dien-2-ol;1-butan-2-yl-1,2,2-trimethylcyclopentane;ethane |
|---|---|
| PubChem CID | 143365281 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | buta-1,3-dien-2-ol;1-butan-2-yl-1,2,2-trimethylcyclopentane;ethane |
| SMILES | C=CC(=C)O.CC.CCC(C)C1(C)CCCC1(C)C |
| InChI | InChI=1S/C12H24.C4H6O.C2H6/c1-6-10(2)12(5)9-7-8-11(12,3)4;1-3-4(2)5;1-2/h10H,6-9H2,1-5H3;3,5H,1-2H2;1-2H3 |
| InChIKey | DWGNOMDGFDRFFB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|