2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid

C13H23NO2 — CID 174480501

IUPAC2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid
SMILESC=CC(C(=O)O)C1(C)CCCN(C)C1(C)C
InChIInChI=1S/C13H23NO2/c1-6-10(11(15)16)13(4)8-7-9-14(5)12(13,2)3/h6,10H,1,7-9H2,2-5H3,(H,15,16)
InChIKeyZZAAGSVBNBGTOU-UHFFFAOYSA-N
MW225.33 g/mol
LogP2.38
Rot. Bonds3

About 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid

2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid (PubChem CID 174480501) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid.

Molecular Properties

Compound Name2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid
PubChem CID174480501
Molecular FormulaC13H23NO2
Molecular Weight225.33 g/mol
Exact Mass225.17
IUPAC Name2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid
SMILESC=CC(C(=O)O)C1(C)CCCN(C)C1(C)C
InChIInChI=1S/C13H23NO2/c1-6-10(11(15)16)13(4)8-7-9-14(5)12(13,2)3/h6,10H,1,7-9H2,2-5H3,(H,15,16)
InChIKeyZZAAGSVBNBGTOU-UHFFFAOYSA-N
XLogP2.38
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.33
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid?
The IUPAC name of 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid (CID 174480501) is 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid.
What is the SMILES notation for 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid?
The canonical SMILES for 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid is C=CC(C(=O)O)C1(C)CCCN(C)C1(C)C.
What is the InChIKey of 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid?
The InChIKey is ZZAAGSVBNBGTOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-6-10(11(15)16)13(4)8-7-9-14(5)12(13,2)3/h6,10H,1,7-9H2,2-5H3,(H,15,16).
What are the key properties of 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid?
2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid has a molecular weight of 225.33 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,2,3-tetramethylpiperidin-3-yl)but-3-enoic acid is sourced from PubChem (CID 174480501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).