C34H40O3S — CID 143366142
O-methyl 2-[4-[2-hydroxy-4-[3-[4-(3-hydroxy-4,4-dimethylpent-1-ynyl)-3-methylphenyl]pentan-3-yl]phenyl]phenyl]ethanethioate (PubChem CID 143366142) has the molecular formula C34H40O3S and a molecular weight of 528.76 g/mol. Its IUPAC name is O-methyl 2-[4-[2-hydroxy-4-[3-[4-(3-hydroxy-4,4-dimethylpent-1-ynyl)-3-methylphenyl]pentan-3-yl]phenyl]phenyl]ethanethioate.
| Compound Name | O-methyl 2-[4-[2-hydroxy-4-[3-[4-(3-hydroxy-4,4-dimethylpent-1-ynyl)-3-methylphenyl]pentan-3-yl]phenyl]phenyl]ethanethioate |
|---|---|
| PubChem CID | 143366142 |
| Molecular Formula | C34H40O3S |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | O-methyl 2-[4-[2-hydroxy-4-[3-[4-(3-hydroxy-4,4-dimethylpent-1-ynyl)-3-methylphenyl]pentan-3-yl]phenyl]phenyl]ethanethioate |
| SMILES | CCC(CC)(c1ccc(C#CC(O)C(C)(C)C)c(C)c1)c1ccc(-c2ccc(CC(=S)OC)cc2)c(O)c1 |
| InChI | InChI=1S/C34H40O3S/c1-8-34(9-2,27-16-14-25(23(3)20-27)15-19-31(36)33(4,5)6)28-17-18-29(30(35)22-28)26-12-10-24(11-13-26)21-32(38)37-7/h10-14,16-18,20,22,31,35-36H,8-9,21H2,1-7H3 |
| InChIKey | PBAQWJPOEMTNCV-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|