C8H15N3 — CID 143366519
(3Z)-3-(ethylideneamino)-4-N-methylpenta-1,3-diene-2,4-diamine (PubChem CID 143366519) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is (3Z)-3-(ethylideneamino)-4-N-methylpenta-1,3-diene-2,4-diamine.
| Compound Name | (3Z)-3-(ethylideneamino)-4-N-methylpenta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 143366519 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (3Z)-3-(ethylideneamino)-4-N-methylpenta-1,3-diene-2,4-diamine |
| SMILES | C=C(N)C(/N=C/C)=C(\C)NC |
| InChI | InChI=1S/C8H15N3/c1-5-11-8(6(2)9)7(3)10-4/h5,10H,2,9H2,1,3-4H3/b8-7-,11-5+ |
| InChIKey | VXMYDPYBWXJMAF-LTCQKBRTSA-N |
| XLogP | 1.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|