C17H36N2O5 — CID 143370340
1-(2-ethyl-2-methylpentoxy)-3-[2-[[hydroxy(oxiran-2-ylmethoxy)methyl]amino]ethylamino]propan-2-ol (PubChem CID 143370340) has the molecular formula C17H36N2O5 and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-(2-ethyl-2-methylpentoxy)-3-[2-[[hydroxy(oxiran-2-ylmethoxy)methyl]amino]ethylamino]propan-2-ol.
| Compound Name | 1-(2-ethyl-2-methylpentoxy)-3-[2-[[hydroxy(oxiran-2-ylmethoxy)methyl]amino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 143370340 |
| Molecular Formula | C17H36N2O5 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 1-(2-ethyl-2-methylpentoxy)-3-[2-[[hydroxy(oxiran-2-ylmethoxy)methyl]amino]ethylamino]propan-2-ol |
| SMILES | CCCC(C)(CC)COCC(O)CNCCNC(O)OCC1CO1 |
| InChI | InChI=1S/C17H36N2O5/c1-4-6-17(3,5-2)13-22-10-14(20)9-18-7-8-19-16(21)24-12-15-11-23-15/h14-16,18-21H,4-13H2,1-3H3 |
| InChIKey | PXMKLDDRHRELFK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|