C21H31N5OS — CID 143371236
7-[3-(4-methylsulfanylpiperazin-1-yl)propoxy]-4-piperidin-4-ylquinazoline (PubChem CID 143371236) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 7-[3-(4-methylsulfanylpiperazin-1-yl)propoxy]-4-piperidin-4-ylquinazoline.
| Compound Name | 7-[3-(4-methylsulfanylpiperazin-1-yl)propoxy]-4-piperidin-4-ylquinazoline |
|---|---|
| PubChem CID | 143371236 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 7-[3-(4-methylsulfanylpiperazin-1-yl)propoxy]-4-piperidin-4-ylquinazoline |
| SMILES | CSN1CCN(CCCOc2ccc3c(C4CCNCC4)ncnc3c2)CC1 |
| InChI | InChI=1S/C21H31N5OS/c1-28-26-12-10-25(11-13-26)9-2-14-27-18-3-4-19-20(15-18)23-16-24-21(19)17-5-7-22-8-6-17/h3-4,15-17,22H,2,5-14H2,1H3 |
| InChIKey | JPWLHXITMQUHMU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|