C13H30N4 — CID 143371386
ethane;N-ethyl-N,3-dimethyl-1,2,4-triazol-4-amine;prop-1-ene (PubChem CID 143371386) has the molecular formula C13H30N4 and a molecular weight of 242.41 g/mol. Its IUPAC name is ethane;N-ethyl-N,3-dimethyl-1,2,4-triazol-4-amine;prop-1-ene.
| Compound Name | ethane;N-ethyl-N,3-dimethyl-1,2,4-triazol-4-amine;prop-1-ene |
|---|---|
| PubChem CID | 143371386 |
| Molecular Formula | C13H30N4 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | ethane;N-ethyl-N,3-dimethyl-1,2,4-triazol-4-amine;prop-1-ene |
| SMILES | C=CC.CC.CC.CCN(C)n1cnnc1C |
| InChI | InChI=1S/C6H12N4.C3H6.2C2H6/c1-4-9(3)10-5-7-8-6(10)2;1-3-2;2*1-2/h5H,4H2,1-3H3;3H,1H2,2H3;2*1-2H3 |
| InChIKey | BJLIPQAQMSLSJU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|