C12H20F2O2 — CID 143372447
1,1-difluoro-2-methyl-3-[(2Z,4Z)-4-methylhepta-2,4-dienoxy]propan-2-ol (PubChem CID 143372447) has the molecular formula C12H20F2O2 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1,1-difluoro-2-methyl-3-[(2Z,4Z)-4-methylhepta-2,4-dienoxy]propan-2-ol.
| Compound Name | 1,1-difluoro-2-methyl-3-[(2Z,4Z)-4-methylhepta-2,4-dienoxy]propan-2-ol |
|---|---|
| PubChem CID | 143372447 |
| Molecular Formula | C12H20F2O2 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1,1-difluoro-2-methyl-3-[(2Z,4Z)-4-methylhepta-2,4-dienoxy]propan-2-ol |
| SMILES | CC/C=C(C)\C=C/COCC(C)(O)C(F)F |
| InChI | InChI=1S/C12H20F2O2/c1-4-6-10(2)7-5-8-16-9-12(3,15)11(13)14/h5-7,11,15H,4,8-9H2,1-3H3/b7-5-,10-6- |
| InChIKey | FNZBLDFEUCOOJT-FWXHXWNTSA-N |
| XLogP | 2.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|