C26H31F3O3 — CID 143772566
1-[(4E,8Z,12Z)-4,12,13-trifluoro-3,6,7,10,11-pentamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraen-2-yl]oxypropan-2-ol (PubChem CID 143772566) has the molecular formula C26H31F3O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-[(4E,8Z,12Z)-4,12,13-trifluoro-3,6,7,10,11-pentamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraen-2-yl]oxypropan-2-ol.
| Compound Name | 1-[(4E,8Z,12Z)-4,12,13-trifluoro-3,6,7,10,11-pentamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraen-2-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 143772566 |
| Molecular Formula | C26H31F3O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-[(4E,8Z,12Z)-4,12,13-trifluoro-3,6,7,10,11-pentamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraen-2-yl]oxypropan-2-ol |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C/C(=C)C(=C)/C=C(/F)C(=C)C(C)OCC(C)O |
| InChI | InChI=1S/C26H31F3O3/c1-10-13-31-23(9)26(29)25(28)20(6)17(3)12-11-16(2)18(4)14-24(27)21(7)22(8)32-15-19(5)30/h10-12,14,19,22,30H,1-4,6-7,9,13,15H2,5,8H3/b12-11-,24-14+,26-25- |
| InChIKey | KAEWWELBHJPTMW-WINWZCMISA-N |
| XLogP | 6.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|