C29H35F3O2 — CID 143772461
(4E,7E,11Z,15Z)-8,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylidene-17-pent-4-enoxyoctadeca-4,7,11,15,17-pentaen-2-ol (PubChem CID 143772461) has the molecular formula C29H35F3O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is (4E,7E,11Z,15Z)-8,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylidene-17-pent-4-enoxyoctadeca-4,7,11,15,17-pentaen-2-ol.
| Compound Name | (4E,7E,11Z,15Z)-8,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylidene-17-pent-4-enoxyoctadeca-4,7,11,15,17-pentaen-2-ol |
|---|---|
| PubChem CID | 143772461 |
| Molecular Formula | C29H35F3O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (4E,7E,11Z,15Z)-8,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylidene-17-pent-4-enoxyoctadeca-4,7,11,15,17-pentaen-2-ol |
| SMILES | C=CCCCOC(=C)/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C/C(=C)/C(C)=C/CC(C)O |
| InChI | InChI=1S/C29H35F3O2/c1-10-11-12-17-34-26(9)29(32)28(31)25(8)21(4)14-13-20(3)24(7)27(30)18-22(5)19(2)15-16-23(6)33/h10,13-15,18,23,33H,1,3-5,7-9,11-12,16-17H2,2,6H3/b14-13-,19-15+,27-18+,29-28- |
| InChIKey | XDCMZBCKRDWXPZ-FLHVCHEKSA-N |
| XLogP | 8.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|