C14H15F3O2 — CID 142512819
(3Z,7Z)-9-ethoxy-3,7,8-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-ol (PubChem CID 142512819) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is (3Z,7Z)-9-ethoxy-3,7,8-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-ol.
| Compound Name | (3Z,7Z)-9-ethoxy-3,7,8-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-ol |
|---|---|
| PubChem CID | 142512819 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (3Z,7Z)-9-ethoxy-3,7,8-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-4-ol |
| SMILES | C=C/C(F)=C(/O)C(=C)C(=C)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C14H15F3O2/c1-6-11(15)14(18)9(4)8(3)12(16)13(17)10(5)19-7-2/h6,18H,1,3-5,7H2,2H3/b13-12-,14-11- |
| InChIKey | VTUNBAMZQMWGIM-NIHAPQRKSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|