C14H23FO2 — CID 90947577
6-(2-fluoro-2-methylbutoxy)-3-methylocta-3,5,7-trien-2-ol (PubChem CID 90947577) has the molecular formula C14H23FO2 and a molecular weight of 242.33 g/mol. Its IUPAC name is 6-(2-fluoro-2-methylbutoxy)-3-methylocta-3,5,7-trien-2-ol.
| Compound Name | 6-(2-fluoro-2-methylbutoxy)-3-methylocta-3,5,7-trien-2-ol |
|---|---|
| PubChem CID | 90947577 |
| Molecular Formula | C14H23FO2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 6-(2-fluoro-2-methylbutoxy)-3-methylocta-3,5,7-trien-2-ol |
| SMILES | C=CC(=CC=C(C)C(C)O)OCC(C)(F)CC |
| InChI | InChI=1S/C14H23FO2/c1-6-13(9-8-11(3)12(4)16)17-10-14(5,15)7-2/h6,8-9,12,16H,1,7,10H2,2-5H3 |
| InChIKey | ZOGNOPXYOUNTIN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|