C16H22F2O2 — CID 144515913
(2E,4E)-5-[(2Z,4E)-6-fluorohepta-2,4-dien-4-yl]oxy-2-[(E)-2-fluoroprop-1-enyl]hexa-2,4-dien-1-ol (PubChem CID 144515913) has the molecular formula C16H22F2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is (2E,4E)-5-[(2Z,4E)-6-fluorohepta-2,4-dien-4-yl]oxy-2-[(E)-2-fluoroprop-1-enyl]hexa-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-[(2Z,4E)-6-fluorohepta-2,4-dien-4-yl]oxy-2-[(E)-2-fluoroprop-1-enyl]hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 144515913 |
| Molecular Formula | C16H22F2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2E,4E)-5-[(2Z,4E)-6-fluorohepta-2,4-dien-4-yl]oxy-2-[(E)-2-fluoroprop-1-enyl]hexa-2,4-dien-1-ol |
| SMILES | C/C=C\C(=C/C(C)F)O/C(C)=C/C=C(\C=C(/C)F)CO |
| InChI | InChI=1S/C16H22F2O2/c1-5-6-16(10-13(3)18)20-14(4)7-8-15(11-19)9-12(2)17/h5-10,13,19H,11H2,1-4H3/b6-5-,12-9+,14-7+,15-8+,16-10+ |
| InChIKey | YHQAMOMVVQCSKL-NOFCIJOPSA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|