C17H29N5 — CID 143378403
4-[4-(6-amino-7-ethyl-3-methyl-2,7-dihydro-1H-azepin-4-yl)piperazin-1-yl]butanenitrile (PubChem CID 143378403) has the molecular formula C17H29N5 and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-[4-(6-amino-7-ethyl-3-methyl-2,7-dihydro-1H-azepin-4-yl)piperazin-1-yl]butanenitrile.
| Compound Name | 4-[4-(6-amino-7-ethyl-3-methyl-2,7-dihydro-1H-azepin-4-yl)piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 143378403 |
| Molecular Formula | C17H29N5 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 4-[4-(6-amino-7-ethyl-3-methyl-2,7-dihydro-1H-azepin-4-yl)piperazin-1-yl]butanenitrile |
| SMILES | CCC1NCC(C)=C(N2CCN(CCCC#N)CC2)C=C1N |
| InChI | InChI=1S/C17H29N5/c1-3-16-15(19)12-17(14(2)13-20-16)22-10-8-21(9-11-22)7-5-4-6-18/h12,16,20H,3-5,7-11,13,19H2,1-2H3 |
| InChIKey | NPVKEVFZGKHMCZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|