C28H25Cl2F3N4 — CID 143379996
(E)-6-(2-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-N-[(E)-propylideneamino]pyridazin-3-imine;1-methyl-4-(trifluoromethyl)benzene (PubChem CID 143379996) has the molecular formula C28H25Cl2F3N4 and a molecular weight of 545.44 g/mol. Its IUPAC name is (E)-6-(2-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-N-[(E)-propylideneamino]pyridazin-3-imine;1-methyl-4-(trifluoromethyl)benzene.
| Compound Name | (E)-6-(2-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-N-[(E)-propylideneamino]pyridazin-3-imine;1-methyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143379996 |
| Molecular Formula | C28H25Cl2F3N4 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | (E)-6-(2-chlorophenyl)-5-(4-chlorophenyl)-2-methyl-N-[(E)-propylideneamino]pyridazin-3-imine;1-methyl-4-(trifluoromethyl)benzene |
| SMILES | CC/C=N/N=c1/cc(-c2ccc(Cl)cc2)c(-c2ccccc2Cl)nn1C.Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18Cl2N4.C8H7F3/c1-3-12-23-24-19-13-17(14-8-10-15(21)11-9-14)20(25-26(19)2)16-6-4-5-7-18(16)22;1-6-2-4-7(5-3-6)8(9,10)11/h4-13H,3H2,1-2H3;2-5H,1H3/b23-12+,24-19-; |
| InChIKey | PPRPKPUCLCEZQF-XVCUSCPSSA-N |
| XLogP | 8.37 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|